About 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide
2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide (PubChem CID 174177876) has the molecular formula C18H23N3O3
and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide |
| PubChem CID | 174177876 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide |
| SMILES | CNC(=O)c1[nH]c(C(=O)NC(C)C)cc1OC(C)c1ccccc1 |
| InChI | InChI=1S/C18H23N3O3/c1-11(2)20-17(22)14-10-15(16(21-14)18(23)19-4)24-12(3)13-8-6-5-7-9-13/h5-12,21H,1-4H3,(H,19,23)(H,20,22) |
| InChIKey | IWANLFOAVQWIBU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide?
The IUPAC name of 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide (CID 174177876) is 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide.
What is the SMILES notation for 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide?
The canonical SMILES for 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide is CNC(=O)c1[nH]c(C(=O)NC(C)C)cc1OC(C)c1ccccc1.
What is the InChIKey of 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide?
The InChIKey is IWANLFOAVQWIBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O3/c1-11(2)20-17(22)14-10-15(16(21-14)18(23)19-4)24-12(3)13-8-6-5-7-9-13/h5-12,21H,1-4H3,(H,19,23)(H,20,22).
What are the key properties of 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide?
2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide has a molecular weight of 329.40 g/mol, XLogP of 2.65, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-methyl-3-(1-phenylethoxy)-5-N-propan-2-yl-1H-pyrrole-2,5-dicarboxamide is sourced from PubChem (CID 174177876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).