C10H19FN2O2S — CID 174177972
2-[[[C-(1-fluoroethylsulfanyl)-N-methylcarbonimidoyl]amino]methyl]pentanoic acid (PubChem CID 174177972) has the molecular formula C10H19FN2O2S and a molecular weight of 250.34 g/mol. Its IUPAC name is 2-[[[C-(1-fluoroethylsulfanyl)-N-methylcarbonimidoyl]amino]methyl]pentanoic acid.
| Compound Name | 2-[[[C-(1-fluoroethylsulfanyl)-N-methylcarbonimidoyl]amino]methyl]pentanoic acid |
|---|---|
| PubChem CID | 174177972 |
| Molecular Formula | C10H19FN2O2S |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-[[[C-(1-fluoroethylsulfanyl)-N-methylcarbonimidoyl]amino]methyl]pentanoic acid |
| SMILES | CCCC(CN/C(=N/C)SC(C)F)C(=O)O |
| InChI | InChI=1S/C10H19FN2O2S/c1-4-5-8(9(14)15)6-13-10(12-3)16-7(2)11/h7-8H,4-6H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | SNKHARJCAPTZPM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|