C23H32O — CID 174178132
(9S,10R,13S,14S,17S)-10,13,17-trimethyl-17-prop-1-ynyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 174178132) has the molecular formula C23H32O and a molecular weight of 324.51 g/mol. Its IUPAC name is (9S,10R,13S,14S,17S)-10,13,17-trimethyl-17-prop-1-ynyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (9S,10R,13S,14S,17S)-10,13,17-trimethyl-17-prop-1-ynyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 174178132 |
| Molecular Formula | C23H32O |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (9S,10R,13S,14S,17S)-10,13,17-trimethyl-17-prop-1-ynyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@@]1(C)CC[C@H]2C3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H32O/c1-5-11-21(2)12-9-20-18-7-6-16-15-17(24)8-13-22(16,3)19(18)10-14-23(20,21)4/h15,18-20H,6-10,12-14H2,1-4H3/t18?,19-,20-,21-,22-,23-/m0/s1 |
| InChIKey | HRRQLQILNFKDLP-ZACNITIVSA-N |
| XLogP | 5.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|