C19H28O4 — CID 174178830
(3Z,5E)-4-ethenyl-3-methoxy-5-[3-(2-methoxyethoxy)prop-1-en-2-yl]-8-methylnona-3,5,7-trien-2-one (PubChem CID 174178830) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is (3Z,5E)-4-ethenyl-3-methoxy-5-[3-(2-methoxyethoxy)prop-1-en-2-yl]-8-methylnona-3,5,7-trien-2-one.
| Compound Name | (3Z,5E)-4-ethenyl-3-methoxy-5-[3-(2-methoxyethoxy)prop-1-en-2-yl]-8-methylnona-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 174178830 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | (3Z,5E)-4-ethenyl-3-methoxy-5-[3-(2-methoxyethoxy)prop-1-en-2-yl]-8-methylnona-3,5,7-trien-2-one |
| SMILES | C=CC(/C(=C\C=C(C)C)C(=C)COCCOC)=C(/OC)C(C)=O |
| InChI | InChI=1S/C19H28O4/c1-8-17(19(22-7)16(5)20)18(10-9-14(2)3)15(4)13-23-12-11-21-6/h8-10H,1,4,11-13H2,2-3,5-7H3/b18-10+,19-17- |
| InChIKey | JZWDQSSFPNGANW-MNVAPZAZSA-N |
| XLogP | 3.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|