C27H41IN2 — CID 174179094
N,N'-bis[2,6-di(propan-2-yl)phenyl]-N'-iodo-N-methylethane-1,2-diamine (PubChem CID 174179094) has the molecular formula C27H41IN2 and a molecular weight of 520.54 g/mol. Its IUPAC name is N,N'-bis[2,6-di(propan-2-yl)phenyl]-N'-iodo-N-methylethane-1,2-diamine.
| Compound Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]-N'-iodo-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 174179094 |
| Molecular Formula | C27H41IN2 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | N,N'-bis[2,6-di(propan-2-yl)phenyl]-N'-iodo-N-methylethane-1,2-diamine |
| SMILES | CC(C)c1cccc(C(C)C)c1N(C)CCN(I)c1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/C27H41IN2/c1-18(2)22-12-10-13-23(19(3)4)26(22)29(9)16-17-30(28)27-24(20(5)6)14-11-15-25(27)21(7)8/h10-15,18-21H,16-17H2,1-9H3 |
| InChIKey | QNQLJZQRYAXEAY-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|