C25H40O — CID 174179245
(9S,10S,13S,14S,17R)-10,13,17-trimethyl-17-[(E)-3-methylbut-1-enyl]-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 174179245) has the molecular formula C25H40O and a molecular weight of 356.59 g/mol. Its IUPAC name is (9S,10S,13S,14S,17R)-10,13,17-trimethyl-17-[(E)-3-methylbut-1-enyl]-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (9S,10S,13S,14S,17R)-10,13,17-trimethyl-17-[(E)-3-methylbut-1-enyl]-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 174179245 |
| Molecular Formula | C25H40O |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.31 |
| IUPAC Name | (9S,10S,13S,14S,17R)-10,13,17-trimethyl-17-[(E)-3-methylbut-1-enyl]-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)/C=C/[C@@]1(C)CC[C@H]2C3CCC4CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C25H40O/c1-17(2)8-12-23(3)13-10-22-20-7-6-18-16-19(26)9-14-24(18,4)21(20)11-15-25(22,23)5/h8,12,17-18,20-22H,6-7,9-11,13-16H2,1-5H3/b12-8+/t18?,20?,21-,22-,23-,24-,25-/m0/s1 |
| InChIKey | AUGPZTYWBSQSOS-TYZPKYFSSA-N |
| XLogP | 6.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|