C23H25F5N4O3 — CID 174180880
[2-fluoro-6-(1,1,2,2-tetrafluoroethoxy)phenyl]-[2-[4-(2-hydroxypropan-2-yl)-6-methylpyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 174180880) has the molecular formula C23H25F5N4O3 and a molecular weight of 500.47 g/mol. Its IUPAC name is [2-fluoro-6-(1,1,2,2-tetrafluoroethoxy)phenyl]-[2-[4-(2-hydroxypropan-2-yl)-6-methylpyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | [2-fluoro-6-(1,1,2,2-tetrafluoroethoxy)phenyl]-[2-[4-(2-hydroxypropan-2-yl)-6-methylpyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 174180880 |
| Molecular Formula | C23H25F5N4O3 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | [2-fluoro-6-(1,1,2,2-tetrafluoroethoxy)phenyl]-[2-[4-(2-hydroxypropan-2-yl)-6-methylpyrimidin-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | Cc1cc(C(C)(C)O)nc(N2CC3CN(C(=O)c4c(F)cccc4OC(F)(F)C(F)F)CC3C2)n1 |
| InChI | InChI=1S/C23H25F5N4O3/c1-12-7-17(22(2,3)34)30-21(29-12)32-10-13-8-31(9-14(13)11-32)19(33)18-15(24)5-4-6-16(18)35-23(27,28)20(25)26/h4-7,13-14,20,34H,8-11H2,1-3H3 |
| InChIKey | UKIJUERPIJOYQM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|