About 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone
1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone (PubChem CID 174181144) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone |
| PubChem CID | 174181144 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone |
| SMILES | CC(=O)C1=C(O)CC(C)(C)CC1O |
| InChI | InChI=1S/C10H16O3/c1-6(11)9-7(12)4-10(2,3)5-8(9)13/h7,12-13H,4-5H2,1-3H3 |
| InChIKey | URWSBCMUMZTCAU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone?
The IUPAC name of 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone (CID 174181144) is 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone.
What is the SMILES notation for 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone?
The canonical SMILES for 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone is CC(=O)C1=C(O)CC(C)(C)CC1O.
What is the InChIKey of 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone?
The InChIKey is URWSBCMUMZTCAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-6(11)9-7(12)4-10(2,3)5-8(9)13/h7,12-13H,4-5H2,1-3H3.
What are the key properties of 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone?
1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone has a molecular weight of 184.23 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dihydroxy-4,4-dimethylcyclohexen-1-yl)ethanone is sourced from PubChem (CID 174181144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).