C22H27NO — CID 174181187
8-tert-butyl-14-(methoxymethyl)-13,15-dimethyl-12-azatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8,11-hexaene (PubChem CID 174181187) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is 8-tert-butyl-14-(methoxymethyl)-13,15-dimethyl-12-azatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8,11-hexaene.
| Compound Name | 8-tert-butyl-14-(methoxymethyl)-13,15-dimethyl-12-azatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8,11-hexaene |
|---|---|
| PubChem CID | 174181187 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 8-tert-butyl-14-(methoxymethyl)-13,15-dimethyl-12-azatetracyclo[8.5.0.02,7.013,15]pentadeca-1(10),2,4,6,8,11-hexaene |
| SMILES | COCC1C2(C)N=Cc3cc(C(C)(C)C)c4ccccc4c3C12C |
| InChI | InChI=1S/C22H27NO/c1-20(2,3)17-11-14-12-23-22(5)18(13-24-6)21(22,4)19(14)16-10-8-7-9-15(16)17/h7-12,18H,13H2,1-6H3 |
| InChIKey | LYJRCZXZHCIPSM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |