C17H21NO — CID 174181913
5-[(1Z)-buta-1,3-dienyl]-6-ethenyl-3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,4-dihydro-1,3-oxazine (PubChem CID 174181913) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-6-ethenyl-3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,4-dihydro-1,3-oxazine.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-6-ethenyl-3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,4-dihydro-1,3-oxazine |
|---|---|
| PubChem CID | 174181913 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-6-ethenyl-3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-2,4-dihydro-1,3-oxazine |
| SMILES | C=C/C=C\C1=C(C=C)OCN(C(/C=C\C=C)=C/C)C1 |
| InChI | InChI=1S/C17H21NO/c1-5-9-11-15-13-18(14-19-17(15)8-4)16(7-3)12-10-6-2/h5-12H,1-2,4,13-14H2,3H3/b11-9-,12-10-,16-7+ |
| InChIKey | BDIDRGFXVGKCJH-BDXUQGPISA-N |
| XLogP | 4.10 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|