C18H29NO — CID 174182571
1-[(5Z,7Z)-4,7-dimethyldeca-1,3,5,7-tetraen-5-yl]-4-methylpiperidin-4-ol (PubChem CID 174182571) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 1-[(5Z,7Z)-4,7-dimethyldeca-1,3,5,7-tetraen-5-yl]-4-methylpiperidin-4-ol.
| Compound Name | 1-[(5Z,7Z)-4,7-dimethyldeca-1,3,5,7-tetraen-5-yl]-4-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 174182571 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 1-[(5Z,7Z)-4,7-dimethyldeca-1,3,5,7-tetraen-5-yl]-4-methylpiperidin-4-ol |
| SMILES | C=CC=C(C)/C(=C/C(C)=C\CC)N1CCC(C)(O)CC1 |
| InChI | InChI=1S/C18H29NO/c1-6-8-15(3)14-17(16(4)9-7-2)19-12-10-18(5,20)11-13-19/h7-9,14,20H,2,6,10-13H2,1,3-5H3/b15-8-,16-9?,17-14- |
| InChIKey | QUPAEWGJYLZCNZ-OGNHQRTPSA-N |
| XLogP | 4.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|