C22H28N2O — CID 174182807
(2E,4E)-4-(1-ethylpyrazol-4-yl)-1-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]hepta-2,4-dien-6-yn-2-ol (PubChem CID 174182807) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is (2E,4E)-4-(1-ethylpyrazol-4-yl)-1-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]hepta-2,4-dien-6-yn-2-ol.
| Compound Name | (2E,4E)-4-(1-ethylpyrazol-4-yl)-1-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]hepta-2,4-dien-6-yn-2-ol |
|---|---|
| PubChem CID | 174182807 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | (2E,4E)-4-(1-ethylpyrazol-4-yl)-1-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]hepta-2,4-dien-6-yn-2-ol |
| SMILES | C#C/C=C(\C=C(\O)C[C@@H]1C=C(C)CC[C@H]1C(=C)C)c1cnn(CC)c1 |
| InChI | InChI=1S/C22H28N2O/c1-6-8-18(20-14-23-24(7-2)15-20)12-21(25)13-19-11-17(5)9-10-22(19)16(3)4/h1,8,11-12,14-15,19,22,25H,3,7,9-10,13H2,2,4-5H3/b18-8+,21-12+/t19-,22-/m0/s1 |
| InChIKey | WPMFBEJMQQPPGK-AEJUNBQXSA-N |
| XLogP | 5.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|