About 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine
3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 174183159) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine.
Molecular Properties
| Compound Name | 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine |
| PubChem CID | 174183159 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | C=C(CCC)c1nnc2cnccn12 |
| InChI | InChI=1S/C10H12N4/c1-3-4-8(2)10-13-12-9-7-11-5-6-14(9)10/h5-7H,2-4H2,1H3 |
| InChIKey | RAIRIHBRVDZADI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine?
The IUPAC name of 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine (CID 174183159) is 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine.
What is the SMILES notation for 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine?
The canonical SMILES for 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine is C=C(CCC)c1nnc2cnccn12.
What is the InChIKey of 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine?
The InChIKey is RAIRIHBRVDZADI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4/c1-3-4-8(2)10-13-12-9-7-11-5-6-14(9)10/h5-7H,2-4H2,1H3.
What are the key properties of 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine?
3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine has a molecular weight of 188.23 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pent-1-en-2-yl-[1,2,4]triazolo[4,3-a]pyrazine is sourced from PubChem (CID 174183159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).