C18H22O4 — CID 174183293
(1S,2R,3S,4R)-1-cyclopenta-2,4-dien-1-yl-1,4-dimethoxy-4-methyl-2,3-dihydronaphthalene-2,3-diol (PubChem CID 174183293) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is (1S,2R,3S,4R)-1-cyclopenta-2,4-dien-1-yl-1,4-dimethoxy-4-methyl-2,3-dihydronaphthalene-2,3-diol.
| Compound Name | (1S,2R,3S,4R)-1-cyclopenta-2,4-dien-1-yl-1,4-dimethoxy-4-methyl-2,3-dihydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 174183293 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (1S,2R,3S,4R)-1-cyclopenta-2,4-dien-1-yl-1,4-dimethoxy-4-methyl-2,3-dihydronaphthalene-2,3-diol |
| SMILES | CO[C@@]1(C2C=CC=C2)c2ccccc2[C@@](C)(OC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H22O4/c1-17(21-2)13-10-6-7-11-14(13)18(22-3,16(20)15(17)19)12-8-4-5-9-12/h4-12,15-16,19-20H,1-3H3/t15-,16+,17+,18-/m0/s1 |
| InChIKey | TWFSFOARIQFNIQ-MLHJIOFPSA-N |
| XLogP | 1.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |