C20H24O4 — CID 174183295
(1R,2S,3R,4S)-1,4-dimethoxy-1-methyl-4-(2-methylphenyl)-2,3-dihydronaphthalene-2,3-diol (PubChem CID 174183295) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (1R,2S,3R,4S)-1,4-dimethoxy-1-methyl-4-(2-methylphenyl)-2,3-dihydronaphthalene-2,3-diol.
| Compound Name | (1R,2S,3R,4S)-1,4-dimethoxy-1-methyl-4-(2-methylphenyl)-2,3-dihydronaphthalene-2,3-diol |
|---|---|
| PubChem CID | 174183295 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | (1R,2S,3R,4S)-1,4-dimethoxy-1-methyl-4-(2-methylphenyl)-2,3-dihydronaphthalene-2,3-diol |
| SMILES | CO[C@@]1(c2ccccc2C)c2ccccc2[C@@](C)(OC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C20H24O4/c1-13-9-5-6-10-14(13)20(24-4)16-12-8-7-11-15(16)19(2,23-3)17(21)18(20)22/h5-12,17-18,21-22H,1-4H3/t17-,18+,19+,20-/m0/s1 |
| InChIKey | MNHIDABULCBLIH-NMLBUPMWSA-N |
| XLogP | 2.48 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |