About 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine
4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine (PubChem CID 174183719) has the molecular formula C14H13Cl2N3S2
and a molecular weight of 358.32 g/mol. Its IUPAC name is 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine.
Molecular Properties
| Compound Name | 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine |
| PubChem CID | 174183719 |
| Molecular Formula | C14H13Cl2N3S2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 356.99 |
| IUPAC Name | 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine |
| SMILES | CCCc1snc(NSc2c[nH]c3cc(Cl)ccc23)c1Cl |
| InChI | InChI=1S/C14H13Cl2N3S2/c1-2-3-11-13(16)14(18-20-11)19-21-12-7-17-10-6-8(15)4-5-9(10)12/h4-7,17H,2-3H2,1H3,(H,18,19) |
| InChIKey | HOOMQZPSRCKMKE-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine?
The IUPAC name of 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine (CID 174183719) is 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine.
What is the SMILES notation for 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine?
The canonical SMILES for 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine is CCCc1snc(NSc2c[nH]c3cc(Cl)ccc23)c1Cl.
What is the InChIKey of 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine?
The InChIKey is HOOMQZPSRCKMKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2N3S2/c1-2-3-11-13(16)14(18-20-11)19-21-12-7-17-10-6-8(15)4-5-9(10)12/h4-7,17H,2-3H2,1H3,(H,18,19).
What are the key properties of 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine?
4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine has a molecular weight of 358.32 g/mol, XLogP of 6.00, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[(6-chloro-1H-indol-3-yl)sulfanyl]-5-propyl-1,2-thiazol-3-amine is sourced from PubChem (CID 174183719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).