C21H16B3N5O3 — CID 174185097
CID 174185097 (PubChem CID 174185097) has the molecular formula C21H16B3N5O3 and a molecular weight of 418.83 g/mol.
| Compound Name | CID 174185097 |
|---|---|
| PubChem CID | 174185097 |
| Molecular Formula | C21H16B3N5O3 |
| Molecular Weight | 418.83 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])Nc1ncc(-c2nc3c(OC)cccc3o2)c2cc(NC(=O)C3CC3)ncc12 |
| InChI | InChI=1S/C21H16B3N5O3/c1-31-14-3-2-4-15-17(14)28-20(32-15)13-9-26-18(29-21(22,23)24)12-8-25-16(7-11(12)13)27-19(30)10-5-6-10/h2-4,7-10H,5-6H2,1H3,(H,26,29)(H,25,27,30) |
| InChIKey | BXBAWYZSRWMRLJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.83 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|