About 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide
6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 174185485) has the molecular formula C15H11O2P
and a molecular weight of 254.23 g/mol. Its IUPAC name is 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide.
Molecular Properties
| Compound Name | 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide |
| PubChem CID | 174185485 |
| Molecular Formula | C15H11O2P |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | C#CCP1(=O)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H11O2P/c1-2-11-18(16)15-10-6-4-8-13(15)12-7-3-5-9-14(12)17-18/h1,3-10H,11H2 |
| InChIKey | HANPRZCVLUKAEW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide?
The IUPAC name of 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide (CID 174185485) is 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide.
What is the SMILES notation for 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide?
The canonical SMILES for 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide is C#CCP1(=O)Oc2ccccc2-c2ccccc21.
What is the InChIKey of 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide?
The InChIKey is HANPRZCVLUKAEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11O2P/c1-2-11-18(16)15-10-6-4-8-13(15)12-7-3-5-9-14(12)17-18/h1,3-10H,11H2.
What are the key properties of 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide?
6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide has a molecular weight of 254.23 g/mol, XLogP of 3.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-prop-2-ynylbenzo[c][2,1]benzoxaphosphinine 6-oxide is sourced from PubChem (CID 174185485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).