C24H26F2N2O4 — CID 174185757
6-[(1S)-2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-3,8-difluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 174185757) has the molecular formula C24H26F2N2O4 and a molecular weight of 444.48 g/mol. Its IUPAC name is 6-[(1S)-2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-3,8-difluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-[(1S)-2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-3,8-difluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 174185757 |
| Molecular Formula | C24H26F2N2O4 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 6-[(1S)-2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-3,8-difluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1Nc2c(F)cc([C@H](O)CN3C[C@H]4C[C@H](Oc5ccccc5)C[C@@]4(O)C3)cc2CC1F |
| InChI | InChI=1S/C24H26F2N2O4/c25-19-7-14(6-15-8-20(26)23(30)27-22(15)19)21(29)12-28-11-16-9-18(10-24(16,31)13-28)32-17-4-2-1-3-5-17/h1-7,16,18,20-21,29,31H,8-13H2,(H,27,30)/t16-,18+,20?,21-,24-/m1/s1 |
| InChIKey | OZIHWDBOZKDMLU-SJIXXUGWSA-N |
| XLogP | 2.60 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |