C23H25FN2O4S — CID 174185814
6-[2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-8-fluoro-1,4-dihydro-3,1-benzothiazin-2-one (PubChem CID 174185814) has the molecular formula C23H25FN2O4S and a molecular weight of 444.53 g/mol. Its IUPAC name is 6-[2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-8-fluoro-1,4-dihydro-3,1-benzothiazin-2-one.
| Compound Name | 6-[2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-8-fluoro-1,4-dihydro-3,1-benzothiazin-2-one |
|---|---|
| PubChem CID | 174185814 |
| Molecular Formula | C23H25FN2O4S |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 6-[2-[(3aS,5S,6aR)-3a-hydroxy-5-phenoxy-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-8-fluoro-1,4-dihydro-3,1-benzothiazin-2-one |
| SMILES | O=C1Nc2c(F)cc(C(O)CN3C[C@H]4C[C@H](Oc5ccccc5)C[C@@]4(O)C3)cc2CS1 |
| InChI | InChI=1S/C23H25FN2O4S/c24-19-7-14(6-15-12-31-22(28)25-21(15)19)20(27)11-26-10-16-8-18(9-23(16,29)13-26)30-17-4-2-1-3-5-17/h1-7,16,18,20,27,29H,8-13H2,(H,25,28)/t16-,18+,20?,23-/m1/s1 |
| InChIKey | XNGBHJNZDZOEJO-FBMZSZPBSA-N |
| XLogP | 3.54 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|