C16H16BrN3O3 — CID 174187051
[6-[(3-bromo-2-methylphenyl)carbamoyl]-3-pyridinyl]methyl-methylcarbamic acid (PubChem CID 174187051) has the molecular formula C16H16BrN3O3 and a molecular weight of 378.23 g/mol. Its IUPAC name is [6-[(3-bromo-2-methylphenyl)carbamoyl]-3-pyridinyl]methyl-methylcarbamic acid.
| Compound Name | [6-[(3-bromo-2-methylphenyl)carbamoyl]-3-pyridinyl]methyl-methylcarbamic acid |
|---|---|
| PubChem CID | 174187051 |
| Molecular Formula | C16H16BrN3O3 |
| Molecular Weight | 378.23 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | [6-[(3-bromo-2-methylphenyl)carbamoyl]-3-pyridinyl]methyl-methylcarbamic acid |
| SMILES | Cc1c(Br)cccc1NC(=O)c1ccc(CN(C)C(=O)O)cn1 |
| InChI | InChI=1S/C16H16BrN3O3/c1-10-12(17)4-3-5-13(10)19-15(21)14-7-6-11(8-18-14)9-20(2)16(22)23/h3-8H,9H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | NJWYYKYWEOGNJF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |