About 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol
4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol (PubChem CID 174187752) has the molecular formula C12H16Cl2N2O2
and a molecular weight of 291.18 g/mol. Its IUPAC name is 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol |
| PubChem CID | 174187752 |
| Molecular Formula | C12H16Cl2N2O2 |
| Molecular Weight | 291.18 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol |
| SMILES | OC1CCC(CCOc2nc(Cl)ncc2Cl)CC1 |
| InChI | InChI=1S/C12H16Cl2N2O2/c13-10-7-15-12(14)16-11(10)18-6-5-8-1-3-9(17)4-2-8/h7-9,17H,1-6H2 |
| InChIKey | LVZOHDGUSYBMJD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol?
The IUPAC name of 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol (CID 174187752) is 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol.
What is the SMILES notation for 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol?
The canonical SMILES for 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol is OC1CCC(CCOc2nc(Cl)ncc2Cl)CC1.
What is the InChIKey of 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol?
The InChIKey is LVZOHDGUSYBMJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16Cl2N2O2/c13-10-7-15-12(14)16-11(10)18-6-5-8-1-3-9(17)4-2-8/h7-9,17H,1-6H2.
What are the key properties of 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol?
4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol has a molecular weight of 291.18 g/mol, XLogP of 3.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2,5-dichloropyrimidin-4-yl)oxyethyl]cyclohexan-1-ol is sourced from PubChem (CID 174187752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).