About 7-piperidin-1-ylthieno[2,3-c]pyridine
7-piperidin-1-ylthieno[2,3-c]pyridine (PubChem CID 174188169) has the molecular formula C12H14N2S
and a molecular weight of 218.33 g/mol. Its IUPAC name is 7-piperidin-1-ylthieno[2,3-c]pyridine.
Molecular Properties
| Compound Name | 7-piperidin-1-ylthieno[2,3-c]pyridine |
| PubChem CID | 174188169 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.33 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 7-piperidin-1-ylthieno[2,3-c]pyridine |
| SMILES | c1cc2ccsc2c(N2CCCCC2)n1 |
| InChI | InChI=1S/C12H14N2S/c1-2-7-14(8-3-1)12-11-10(4-6-13-12)5-9-15-11/h4-6,9H,1-3,7-8H2 |
| InChIKey | MCAADFQWLQSKDZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-piperidin-1-ylthieno[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-piperidin-1-ylthieno[2,3-c]pyridine?
The IUPAC name of 7-piperidin-1-ylthieno[2,3-c]pyridine (CID 174188169) is 7-piperidin-1-ylthieno[2,3-c]pyridine.
What is the SMILES notation for 7-piperidin-1-ylthieno[2,3-c]pyridine?
The canonical SMILES for 7-piperidin-1-ylthieno[2,3-c]pyridine is c1cc2ccsc2c(N2CCCCC2)n1.
What is the InChIKey of 7-piperidin-1-ylthieno[2,3-c]pyridine?
The InChIKey is MCAADFQWLQSKDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S/c1-2-7-14(8-3-1)12-11-10(4-6-13-12)5-9-15-11/h4-6,9H,1-3,7-8H2.
What are the key properties of 7-piperidin-1-ylthieno[2,3-c]pyridine?
7-piperidin-1-ylthieno[2,3-c]pyridine has a molecular weight of 218.33 g/mol, XLogP of 3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-piperidin-1-ylthieno[2,3-c]pyridine is sourced from PubChem (CID 174188169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).