C28H35F3N4O — CID 174188200
2-[4-(cyclopentylamino)phenyl]-6-methyl-N-[4-methyl-3-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-3-carboxamide (PubChem CID 174188200) has the molecular formula C28H35F3N4O and a molecular weight of 500.61 g/mol. Its IUPAC name is 2-[4-(cyclopentylamino)phenyl]-6-methyl-N-[4-methyl-3-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-3-carboxamide.
| Compound Name | 2-[4-(cyclopentylamino)phenyl]-6-methyl-N-[4-methyl-3-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 174188200 |
| Molecular Formula | C28H35F3N4O |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 2-[4-(cyclopentylamino)phenyl]-6-methyl-N-[4-methyl-3-(trifluoromethyl)phenyl]-1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CC3CN(C)CC3NC2c2ccc(NC3CCCC3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C28H35F3N4O/c1-17-7-10-22(14-24(17)28(29,30)31)33-27(36)23-13-19-15-35(2)16-25(19)34-26(23)18-8-11-21(12-9-18)32-20-5-3-4-6-20/h7-12,14,19-20,23,25-26,32,34H,3-6,13,15-16H2,1-2H3,(H,33,36) |
| InChIKey | QBAGNTYDSIHJHZ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |