C24H24F4N4O4 — CID 174188451
[2-fluoro-6-formyl-4-[4-(6-pyrrolidin-1-yl-3-pyridinyl)-1,4-diazepane-1-carbonyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 174188451) has the molecular formula C24H24F4N4O4 and a molecular weight of 508.47 g/mol. Its IUPAC name is [2-fluoro-6-formyl-4-[4-(6-pyrrolidin-1-yl-3-pyridinyl)-1,4-diazepane-1-carbonyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-fluoro-6-formyl-4-[4-(6-pyrrolidin-1-yl-3-pyridinyl)-1,4-diazepane-1-carbonyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174188451 |
| Molecular Formula | C24H24F4N4O4 |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | [2-fluoro-6-formyl-4-[4-(6-pyrrolidin-1-yl-3-pyridinyl)-1,4-diazepane-1-carbonyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | O=Cc1cc(C(=O)N2CCCN(c3ccc(N4CCCC4)nc3)CC2)cc(F)c1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C24H24F4N4O4/c25-19-13-16(12-17(15-33)21(19)36-23(35)24(26,27)28)22(34)32-9-3-8-30(10-11-32)18-4-5-20(29-14-18)31-6-1-2-7-31/h4-5,12-15H,1-3,6-11H2 |
| InChIKey | JSWUDOORNIIDCE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|