About (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one
(4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 174188865) has the molecular formula C18H16Cl2N2O3
and a molecular weight of 379.24 g/mol. Its IUPAC name is (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| PubChem CID | 174188865 |
| Molecular Formula | C18H16Cl2N2O3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC(CC(=O)N1C(=O)OC[C@@H]1c1ccccc1)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2N2O3/c1-11(13-8-15(19)21-16(20)9-13)7-17(23)22-14(10-25-18(22)24)12-5-3-2-4-6-12/h2-6,8-9,11,14H,7,10H2,1H3/t11?,14-/m1/s1 |
| InChIKey | KOWOKWNRAYRPNM-SBXXRYSUSA-N |
| XLogP | 4.60 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one?
The IUPAC name of (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one (CID 174188865) is (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one.
What is the SMILES notation for (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one?
The canonical SMILES for (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one is CC(CC(=O)N1C(=O)OC[C@@H]1c1ccccc1)c1cc(Cl)nc(Cl)c1.
What is the InChIKey of (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one?
The InChIKey is KOWOKWNRAYRPNM-SBXXRYSUSA-N. The full InChI is InChI=1S/C18H16Cl2N2O3/c1-11(13-8-15(19)21-16(20)9-13)7-17(23)22-14(10-25-18(22)24)12-5-3-2-4-6-12/h2-6,8-9,11,14H,7,10H2,1H3/t11?,14-/m1/s1.
What are the key properties of (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one?
(4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one has a molecular weight of 379.24 g/mol, XLogP of 4.60, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3-[3-(2,6-dichloro-4-pyridinyl)butanoyl]-4-phenyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 174188865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).