C31H43ClFN5O6 — CID 174188934
2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-2-[2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2,7-diazaspiro[3.4]octan-7-yl]acetaldehyde (PubChem CID 174188934) has the molecular formula C31H43ClFN5O6 and a molecular weight of 636.16 g/mol. Its IUPAC name is 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-2-[2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2,7-diazaspiro[3.4]octan-7-yl]acetaldehyde.
| Compound Name | 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-2-[2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2,7-diazaspiro[3.4]octan-7-yl]acetaldehyde |
|---|---|
| PubChem CID | 174188934 |
| Molecular Formula | C31H43ClFN5O6 |
| Molecular Weight | 636.16 g/mol |
| Exact Mass | 635.29 |
| IUPAC Name | 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2-fluorophenyl]-2-[2-[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]-2,7-diazaspiro[3.4]octan-7-yl]acetaldehyde |
| SMILES | O=CC(c1ccc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)cc1F)N1CCC2(CN(C[C@H](O)[C@H](O)[C@H](O)CO)C2)C1 |
| InChI | InChI=1S/C31H43ClFN5O6/c32-22-13-34-30(35-14-22)37-8-5-21(6-9-37)2-1-11-44-23-3-4-24(25(33)12-23)26(16-39)38-10-7-31(20-38)18-36(19-31)15-27(41)29(43)28(42)17-40/h3-4,12-14,16,21,26-29,40-43H,1-2,5-11,15,17-20H2/t26?,27-,28+,29-/m0/s1 |
| InChIKey | IVSNIPIMKUESNH-SBIMLLMBSA-N |
| XLogP | 1.67 |
| TPSA | 142.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.16 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|