C31H42ClF2N5O9 — CID 174188957
formyl 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-difluorophenyl]-2-[4-(2,3,4,5,6-pentahydroxyhexyl)piperazin-1-yl]acetate (PubChem CID 174188957) has the molecular formula C31H42ClF2N5O9 and a molecular weight of 702.15 g/mol. Its IUPAC name is formyl 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-difluorophenyl]-2-[4-(2,3,4,5,6-pentahydroxyhexyl)piperazin-1-yl]acetate.
| Compound Name | formyl 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-difluorophenyl]-2-[4-(2,3,4,5,6-pentahydroxyhexyl)piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 174188957 |
| Molecular Formula | C31H42ClF2N5O9 |
| Molecular Weight | 702.15 g/mol |
| Exact Mass | 701.26 |
| IUPAC Name | formyl 2-[4-[3-[1-(5-chloropyrimidin-2-yl)piperidin-4-yl]propoxy]-2,6-difluorophenyl]-2-[4-(2,3,4,5,6-pentahydroxyhexyl)piperazin-1-yl]acetate |
| SMILES | O=COC(=O)C(c1c(F)cc(OCCCC2CCN(c3ncc(Cl)cn3)CC2)cc1F)N1CCN(CC(O)C(O)C(O)C(O)CO)CC1 |
| InChI | InChI=1S/C31H42ClF2N5O9/c32-20-14-35-31(36-15-20)39-5-3-19(4-6-39)2-1-11-47-21-12-22(33)26(23(34)13-21)27(30(46)48-18-41)38-9-7-37(8-10-38)16-24(42)28(44)29(45)25(43)17-40/h12-15,18-19,24-25,27-29,40,42-45H,1-11,16-17H2 |
| InChIKey | BTSVDBHNJOGRHP-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 189.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.15 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|