C23H23N4O5S- — CID 174189129
[1-[[2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-pyridinyl]methyl]azetidin-3-yl]methanesulfinate (PubChem CID 174189129) has the molecular formula C23H23N4O5S- and a molecular weight of 467.53 g/mol. Its IUPAC name is [1-[[2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-pyridinyl]methyl]azetidin-3-yl]methanesulfinate.
| Compound Name | [1-[[2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-pyridinyl]methyl]azetidin-3-yl]methanesulfinate |
|---|---|
| PubChem CID | 174189129 |
| Molecular Formula | C23H23N4O5S- |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | [1-[[2-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-4-pyridinyl]methyl]azetidin-3-yl]methanesulfinate |
| SMILES | O=C1CCC(N2Cc3cc(-c4cc(CN5CC(CS(=O)[O-])C5)ccn4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H24N4O5S/c28-21-4-3-20(22(29)25-21)27-12-17-8-16(1-2-18(17)23(27)30)19-7-14(5-6-24-19)9-26-10-15(11-26)13-33(31)32/h1-2,5-8,15,20H,3-4,9-13H2,(H,31,32)(H,25,28,29)/p-1 |
| InChIKey | HXWLWTPJLGYOAB-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|