C17H13ClF3N5O — CID 174189629
6-(6-chloro-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,5,7,9(14),11-pentaen-7-yl)-4-methyl-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 174189629) has the molecular formula C17H13ClF3N5O and a molecular weight of 395.77 g/mol. Its IUPAC name is 6-(6-chloro-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,5,7,9(14),11-pentaen-7-yl)-4-methyl-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 6-(6-chloro-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,5,7,9(14),11-pentaen-7-yl)-4-methyl-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 174189629 |
| Molecular Formula | C17H13ClF3N5O |
| Molecular Weight | 395.77 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 6-(6-chloro-10-oxa-2,4,13-triazatricyclo[7.4.1.05,14]tetradeca-1,5,7,9(14),11-pentaen-7-yl)-4-methyl-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | Cc1cc(N)nc(-c2cc3c4c(c2Cl)NCN=C4NC=CO3)c1C(F)(F)F |
| InChI | InChI=1S/C17H13ClF3N5O/c1-7-4-10(22)26-14(12(7)17(19,20)21)8-5-9-11-15(13(8)18)24-6-25-16(11)23-2-3-27-9/h2-5,24H,6H2,1H3,(H2,22,26)(H,23,25) |
| InChIKey | IXNGIJBFBIVTEW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.77 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |