C23H29N5O3 — CID 174190304
6-[4-[8-(oxan-4-yl)quinoxalin-2-yl]pyrazol-1-yl]hexylcarbamic acid (PubChem CID 174190304) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is 6-[4-[8-(oxan-4-yl)quinoxalin-2-yl]pyrazol-1-yl]hexylcarbamic acid.
| Compound Name | 6-[4-[8-(oxan-4-yl)quinoxalin-2-yl]pyrazol-1-yl]hexylcarbamic acid |
|---|---|
| PubChem CID | 174190304 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 6-[4-[8-(oxan-4-yl)quinoxalin-2-yl]pyrazol-1-yl]hexylcarbamic acid |
| SMILES | O=C(O)NCCCCCCn1cc(-c2cnc3cccc(C4CCOCC4)c3n2)cn1 |
| InChI | InChI=1S/C23H29N5O3/c29-23(30)24-10-3-1-2-4-11-28-16-18(14-26-28)21-15-25-20-7-5-6-19(22(20)27-21)17-8-12-31-13-9-17/h5-7,14-17,24H,1-4,8-13H2,(H,29,30) |
| InChIKey | JCQJEHGPRQDXCA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|