About ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate
ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate (PubChem CID 17419074) has the molecular formula C14H18N4O2S
and a molecular weight of 306.39 g/mol. Its IUPAC name is ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate |
| PubChem CID | 17419074 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ncnc3ccsc23)CC1 |
| InChI | InChI=1S/C14H18N4O2S/c1-2-20-14(19)18-6-3-10(4-7-18)17-13-12-11(5-8-21-12)15-9-16-13/h5,8-10H,2-4,6-7H2,1H3,(H,15,16,17) |
| InChIKey | FWJGLYBDOUWPSK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate?
The IUPAC name of ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate (CID 17419074) is ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate.
What is the SMILES notation for ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate?
The canonical SMILES for ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate is CCOC(=O)N1CCC(Nc2ncnc3ccsc23)CC1.
What is the InChIKey of ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate?
The InChIKey is FWJGLYBDOUWPSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2S/c1-2-20-14(19)18-6-3-10(4-7-18)17-13-12-11(5-8-21-12)15-9-16-13/h5,8-10H,2-4,6-7H2,1H3,(H,15,16,17).
What are the key properties of ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate?
ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate has a molecular weight of 306.39 g/mol, XLogP of 2.72, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(thieno[3,2-d]pyrimidin-4-ylamino)piperidine-1-carboxylate is sourced from PubChem (CID 17419074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).