C18H30N4S — CID 174190800
2-[2-(4-nonylsulfanylphenyl)ethylideneamino]guanidine (PubChem CID 174190800) has the molecular formula C18H30N4S and a molecular weight of 334.53 g/mol. Its IUPAC name is 2-[2-(4-nonylsulfanylphenyl)ethylideneamino]guanidine.
| Compound Name | 2-[2-(4-nonylsulfanylphenyl)ethylideneamino]guanidine |
|---|---|
| PubChem CID | 174190800 |
| Molecular Formula | C18H30N4S |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | 2-[2-(4-nonylsulfanylphenyl)ethylideneamino]guanidine |
| SMILES | CCCCCCCCCSc1ccc(CC=NN=C(N)N)cc1 |
| InChI | InChI=1S/C18H30N4S/c1-2-3-4-5-6-7-8-15-23-17-11-9-16(10-12-17)13-14-21-22-18(19)20/h9-12,14H,2-8,13,15H2,1H3,(H4,19,20,22) |
| InChIKey | RIQZJTCWSKUWIX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|