C25H27FN4O6 — CID 174190873
[(2R,3R,4S,5R)-2-[4-amino-5-(3,3-diphenylpropylcarbamoyl)-2-oxopyrimidin-1-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] hypofluorite (PubChem CID 174190873) has the molecular formula C25H27FN4O6 and a molecular weight of 498.51 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2-[4-amino-5-(3,3-diphenylpropylcarbamoyl)-2-oxopyrimidin-1-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] hypofluorite.
| Compound Name | [(2R,3R,4S,5R)-2-[4-amino-5-(3,3-diphenylpropylcarbamoyl)-2-oxopyrimidin-1-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] hypofluorite |
|---|---|
| PubChem CID | 174190873 |
| Molecular Formula | C25H27FN4O6 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | [(2R,3R,4S,5R)-2-[4-amino-5-(3,3-diphenylpropylcarbamoyl)-2-oxopyrimidin-1-yl]-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] hypofluorite |
| SMILES | Nc1nc(=O)n([C@@H]2O[C@H](CO)[C@H](O)[C@H]2OF)cc1C(=O)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H27FN4O6/c26-36-21-20(32)19(14-31)35-24(21)30-13-18(22(27)29-25(30)34)23(33)28-12-11-17(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,13,17,19-21,24,31-32H,11-12,14H2,(H,28,33)(H2,27,29,34)/t19-,20+,21-,24-/m1/s1 |
| InChIKey | BNUVZSOAQCVXLA-OOICKAIWSA-N |
| XLogP | 1.30 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |