C25H23N3O4 — CID 17419102
2-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethoxy]-N-phenylbenzamide (PubChem CID 17419102) has the molecular formula C25H23N3O4 and a molecular weight of 429.48 g/mol. Its IUPAC name is 2-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethoxy]-N-phenylbenzamide.
| Compound Name | 2-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethoxy]-N-phenylbenzamide |
|---|---|
| PubChem CID | 17419102 |
| Molecular Formula | C25H23N3O4 |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-[2-oxo-2-[4-(2-oxopyrrolidin-1-yl)anilino]ethoxy]-N-phenylbenzamide |
| SMILES | O=C(COc1ccccc1C(=O)Nc1ccccc1)Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C25H23N3O4/c29-23(26-19-12-14-20(15-13-19)28-16-6-11-24(28)30)17-32-22-10-5-4-9-21(22)25(31)27-18-7-2-1-3-8-18/h1-5,7-10,12-15H,6,11,16-17H2,(H,26,29)(H,27,31) |
| InChIKey | IFMYZCJOXYCUBE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |