C26H34ClF3N4OSi — CID 174191198
6-chloro-N-[1-[3-(1,1-difluoro-2-methyl-2-triethylsilyloxypropyl)-2-fluorophenyl]ethyl]-2-methylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 174191198) has the molecular formula C26H34ClF3N4OSi and a molecular weight of 539.12 g/mol. Its IUPAC name is 6-chloro-N-[1-[3-(1,1-difluoro-2-methyl-2-triethylsilyloxypropyl)-2-fluorophenyl]ethyl]-2-methylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 6-chloro-N-[1-[3-(1,1-difluoro-2-methyl-2-triethylsilyloxypropyl)-2-fluorophenyl]ethyl]-2-methylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 174191198 |
| Molecular Formula | C26H34ClF3N4OSi |
| Molecular Weight | 539.12 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 6-chloro-N-[1-[3-(1,1-difluoro-2-methyl-2-triethylsilyloxypropyl)-2-fluorophenyl]ethyl]-2-methylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CC[Si](CC)(CC)OC(C)(C)C(F)(F)c1cccc(C(C)Nc2nc(C)nc3cnc(Cl)cc23)c1F |
| InChI | InChI=1S/C26H34ClF3N4OSi/c1-8-36(9-2,10-3)35-25(6,7)26(29,30)20-13-11-12-18(23(20)28)16(4)32-24-19-14-22(27)31-15-21(19)33-17(5)34-24/h11-16H,8-10H2,1-7H3,(H,32,33,34) |
| InChIKey | PHBPJRXUYFGCDX-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.12 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|