C26H29ClF3N3O3 — CID 174191983
[4-chloro-3-[2-(2,6-diazaspiro[3.4]octan-6-yl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-4-yl]-5-methylphenyl] 2,2,2-trifluoroacetate (PubChem CID 174191983) has the molecular formula C26H29ClF3N3O3 and a molecular weight of 523.98 g/mol. Its IUPAC name is [4-chloro-3-[2-(2,6-diazaspiro[3.4]octan-6-yl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-4-yl]-5-methylphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-chloro-3-[2-(2,6-diazaspiro[3.4]octan-6-yl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-4-yl]-5-methylphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174191983 |
| Molecular Formula | C26H29ClF3N3O3 |
| Molecular Weight | 523.98 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | [4-chloro-3-[2-(2,6-diazaspiro[3.4]octan-6-yl)-3,7,7-trimethyl-5,8-dihydropyrano[4,3-b]pyridin-4-yl]-5-methylphenyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(OC(=O)C(F)(F)F)cc(-c2c(C)c(N3CCC4(CNC4)C3)nc3c2COC(C)(C)C3)c1Cl |
| InChI | InChI=1S/C26H29ClF3N3O3/c1-14-7-16(36-23(34)26(28,29)30)8-17(21(14)27)20-15(2)22(33-6-5-25(13-33)11-31-12-25)32-19-9-24(3,4)35-10-18(19)20/h7-8,31H,5-6,9-13H2,1-4H3 |
| InChIKey | LOTSSDJQPRFPRR-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.98 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|