C11H13FN2 — CID 174192470
4-[(3Z,5Z)-3-fluoroocta-1,3,5,7-tetraen-4-yl]-2,3-dihydro-1H-imidazole (PubChem CID 174192470) has the molecular formula C11H13FN2 and a molecular weight of 192.24 g/mol. Its IUPAC name is 4-[(3Z,5Z)-3-fluoroocta-1,3,5,7-tetraen-4-yl]-2,3-dihydro-1H-imidazole.
| Compound Name | 4-[(3Z,5Z)-3-fluoroocta-1,3,5,7-tetraen-4-yl]-2,3-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 174192470 |
| Molecular Formula | C11H13FN2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 4-[(3Z,5Z)-3-fluoroocta-1,3,5,7-tetraen-4-yl]-2,3-dihydro-1H-imidazole |
| SMILES | C=C/C=C\C(C1=CNCN1)=C(\F)C=C |
| InChI | InChI=1S/C11H13FN2/c1-3-5-6-9(10(12)4-2)11-7-13-8-14-11/h3-7,13-14H,1-2,8H2/b6-5-,10-9- |
| InChIKey | GNIHORCFPORTDA-WBHJMADESA-N |
| XLogP | 2.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|