C10H11FN4 — CID 174192481
5-[(3Z,5Z)-3-fluoroocta-1,3,5,7-tetraen-4-yl]-1-methyltetrazole (PubChem CID 174192481) has the molecular formula C10H11FN4 and a molecular weight of 206.22 g/mol. Its IUPAC name is 5-[(3Z,5Z)-3-fluoroocta-1,3,5,7-tetraen-4-yl]-1-methyltetrazole.
| Compound Name | 5-[(3Z,5Z)-3-fluoroocta-1,3,5,7-tetraen-4-yl]-1-methyltetrazole |
|---|---|
| PubChem CID | 174192481 |
| Molecular Formula | C10H11FN4 |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 5-[(3Z,5Z)-3-fluoroocta-1,3,5,7-tetraen-4-yl]-1-methyltetrazole |
| SMILES | C=C/C=C\C(=C(\F)C=C)c1nnnn1C |
| InChI | InChI=1S/C10H11FN4/c1-4-6-7-8(9(11)5-2)10-12-13-14-15(10)3/h4-7H,1-2H2,3H3/b7-6-,9-8- |
| InChIKey | NOZDMLJFEKWISE-JPDBVBESSA-N |
| XLogP | 1.82 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|