C13H24N4S — CID 174192834
N'-butan-2-yl-N-ethenyl-N'-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine (PubChem CID 174192834) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is N'-butan-2-yl-N-ethenyl-N'-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine.
| Compound Name | N'-butan-2-yl-N-ethenyl-N'-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 174192834 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N'-butan-2-yl-N-ethenyl-N'-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine |
| SMILES | C=CNCCN(Cc1cnc(NC)s1)C(C)CC |
| InChI | InChI=1S/C13H24N4S/c1-5-11(3)17(8-7-15-6-2)10-12-9-16-13(14-4)18-12/h6,9,11,15H,2,5,7-8,10H2,1,3-4H3,(H,14,16) |
| InChIKey | ATYOJHQNAIAMMA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|