C17H27BCl3NO4 — CID 174193006
(7aR)-7a-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one (PubChem CID 174193006) has the molecular formula C17H27BCl3NO4 and a molecular weight of 426.58 g/mol. Its IUPAC name is (7aR)-7a-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one.
| Compound Name | (7aR)-7a-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
|---|---|
| PubChem CID | 174193006 |
| Molecular Formula | C17H27BCl3NO4 |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (7aR)-7a-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butyl]-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
| SMILES | CC1(C)OB(CCCC[C@]23CCCN2C(C(Cl)(Cl)Cl)OC3=O)OC1(C)C |
| InChI | InChI=1S/C17H27BCl3NO4/c1-14(2)15(3,4)26-18(25-14)10-6-5-8-16-9-7-11-22(16)12(17(19,20)21)24-13(16)23/h12H,5-11H2,1-4H3/t12?,16-/m1/s1 |
| InChIKey | BLINUBJGIHWDPY-PVQCJRHBSA-N |
| XLogP | 4.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|