About 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile
1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile (PubChem CID 174193007) has the molecular formula C10H15BN4S
and a molecular weight of 234.14 g/mol. Its IUPAC name is 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile.
Molecular Properties
| Compound Name | 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile |
| PubChem CID | 174193007 |
| Molecular Formula | C10H15BN4S |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile |
| SMILES | CNc1ncc(CN2CCB(C#N)CC2)s1 |
| InChI | InChI=1S/C10H15BN4S/c1-13-10-14-6-9(16-10)7-15-4-2-11(8-12)3-5-15/h6H,2-5,7H2,1H3,(H,13,14) |
| InChIKey | IRJPXFNLOKXDAY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile?
The IUPAC name of 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile (CID 174193007) is 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile.
What is the SMILES notation for 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile?
The canonical SMILES for 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile is CNc1ncc(CN2CCB(C#N)CC2)s1.
What is the InChIKey of 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile?
The InChIKey is IRJPXFNLOKXDAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BN4S/c1-13-10-14-6-9(16-10)7-15-4-2-11(8-12)3-5-15/h6H,2-5,7H2,1H3,(H,13,14).
What are the key properties of 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile?
1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile has a molecular weight of 234.14 g/mol, XLogP of 1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(methylamino)-1,3-thiazol-5-yl]methyl]-1,4-azaborinane-4-carbonitrile is sourced from PubChem (CID 174193007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).