C11H14N2O3 — CID 174193097
(8b-hydroxy-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indol-2-yl)methanediol (PubChem CID 174193097) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is (8b-hydroxy-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indol-2-yl)methanediol.
| Compound Name | (8b-hydroxy-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indol-2-yl)methanediol |
|---|---|
| PubChem CID | 174193097 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (8b-hydroxy-2,3,3a,4-tetrahydro-1H-pyrrolo[2,3-b]indol-2-yl)methanediol |
| SMILES | OC(O)C1CC2(O)c3ccccc3NC2N1 |
| InChI | InChI=1S/C11H14N2O3/c14-9(15)8-5-11(16)6-3-1-2-4-7(6)12-10(11)13-8/h1-4,8-10,12-16H,5H2 |
| InChIKey | HIOIWCJPGICWGR-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|