About (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine
(3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine (PubChem CID 174193484) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine.
Molecular Properties
| Compound Name | (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine |
| PubChem CID | 174193484 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine |
| SMILES | C=C/C=C(\CC(C)CC)C(C)NC |
| InChI | InChI=1S/C12H23N/c1-6-8-12(11(4)13-5)9-10(3)7-2/h6,8,10-11,13H,1,7,9H2,2-5H3/b12-8+ |
| InChIKey | RYFJMINKIHLXCD-XYOKQWHBSA-N |
| XLogP | 3.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine?
The IUPAC name of (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine (CID 174193484) is (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine.
What is the SMILES notation for (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine?
The canonical SMILES for (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine is C=C/C=C(\CC(C)CC)C(C)NC.
What is the InChIKey of (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine?
The InChIKey is RYFJMINKIHLXCD-XYOKQWHBSA-N. The full InChI is InChI=1S/C12H23N/c1-6-8-12(11(4)13-5)9-10(3)7-2/h6,8,10-11,13H,1,7,9H2,2-5H3/b12-8+.
What are the key properties of (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine?
(3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine has a molecular weight of 181.32 g/mol, XLogP of 3.14, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N,5-dimethyl-3-prop-2-enylideneheptan-2-amine is sourced from PubChem (CID 174193484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).