C18H26N8O2 — CID 174193595
hydrazinyl-[2-(5-methyl-1H-imidazol-4-yl)-3-(2-morpholin-4-ylethylamino)imidazo[1,2-a]pyridin-6-yl]methanol (PubChem CID 174193595) has the molecular formula C18H26N8O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is hydrazinyl-[2-(5-methyl-1H-imidazol-4-yl)-3-(2-morpholin-4-ylethylamino)imidazo[1,2-a]pyridin-6-yl]methanol.
| Compound Name | hydrazinyl-[2-(5-methyl-1H-imidazol-4-yl)-3-(2-morpholin-4-ylethylamino)imidazo[1,2-a]pyridin-6-yl]methanol |
|---|---|
| PubChem CID | 174193595 |
| Molecular Formula | C18H26N8O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | hydrazinyl-[2-(5-methyl-1H-imidazol-4-yl)-3-(2-morpholin-4-ylethylamino)imidazo[1,2-a]pyridin-6-yl]methanol |
| SMILES | Cc1[nH]cnc1-c1nc2ccc(C(O)NN)cn2c1NCCN1CCOCC1 |
| InChI | InChI=1S/C18H26N8O2/c1-12-15(22-11-21-12)16-17(20-4-5-25-6-8-28-9-7-25)26-10-13(18(27)24-19)2-3-14(26)23-16/h2-3,10-11,18,20,24,27H,4-9,19H2,1H3,(H,21,22) |
| InChIKey | PEQNFDACLRNKNX-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 128.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|