C32H45NO4S2 — CID 174193607
7-[3,5-bis[[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxy]phenyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene (PubChem CID 174193607) has the molecular formula C32H45NO4S2 and a molecular weight of 571.85 g/mol. Its IUPAC name is 7-[3,5-bis[[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxy]phenyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene.
| Compound Name | 7-[3,5-bis[[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxy]phenyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
|---|---|
| PubChem CID | 174193607 |
| Molecular Formula | C32H45NO4S2 |
| Molecular Weight | 571.85 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 7-[3,5-bis[[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]oxy]phenyl]-3,11-dithia-7-azatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraene |
| SMILES | CC(C)(C)OCCC(C)(C)Oc1cc(OC(C)(C)CCOC(C)(C)C)cc(-n2c3ccsc3c3sccc32)c1 |
| InChI | InChI=1S/C32H45NO4S2/c1-29(2,3)34-15-13-31(7,8)36-23-19-22(33-25-11-17-38-27(25)28-26(33)12-18-39-28)20-24(21-23)37-32(9,10)14-16-35-30(4,5)6/h11-12,17-21H,13-16H2,1-10H3 |
| InChIKey | GWVZCRKWCKBGIV-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.85 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |