C28H9F4N7O2 — CID 174193977
2-[(6Z)-4,8-bis(4-cyano-3,5-difluorophenyl)-6-(1-cyanoethylidene)-3,7-dihydro-[1,3]oxazolo[5,4-f][1,3]benzoxazol-2-ylidene]propanedinitrile (PubChem CID 174193977) has the molecular formula C28H9F4N7O2 and a molecular weight of 551.42 g/mol. Its IUPAC name is 2-[(6Z)-4,8-bis(4-cyano-3,5-difluorophenyl)-6-(1-cyanoethylidene)-3,7-dihydro-[1,3]oxazolo[5,4-f][1,3]benzoxazol-2-ylidene]propanedinitrile.
| Compound Name | 2-[(6Z)-4,8-bis(4-cyano-3,5-difluorophenyl)-6-(1-cyanoethylidene)-3,7-dihydro-[1,3]oxazolo[5,4-f][1,3]benzoxazol-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 174193977 |
| Molecular Formula | C28H9F4N7O2 |
| Molecular Weight | 551.42 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 2-[(6Z)-4,8-bis(4-cyano-3,5-difluorophenyl)-6-(1-cyanoethylidene)-3,7-dihydro-[1,3]oxazolo[5,4-f][1,3]benzoxazol-2-ylidene]propanedinitrile |
| SMILES | C/C(C#N)=C1\Nc2c(c(-c3cc(F)c(C#N)c(F)c3)c3c(c2-c2cc(F)c(C#N)c(F)c2)OC(=C(C#N)C#N)N3)O1 |
| InChI | InChI=1S/C28H9F4N7O2/c1-11(6-33)27-38-23-21(12-2-17(29)15(9-36)18(30)3-12)26-24(39-28(41-26)14(7-34)8-35)22(25(23)40-27)13-4-19(31)16(10-37)20(32)5-13/h2-5,38-39H,1H3/b27-11- |
| InChIKey | ZQWLLRSDJKGDMA-BCHBDCPOSA-N |
| XLogP | 5.94 |
| TPSA | 161.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.42 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|