About ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium
ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium (PubChem CID 174194136) has the molecular formula C11H16N+
and a molecular weight of 162.26 g/mol. Its IUPAC name is ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium.
Molecular Properties
| Compound Name | ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium |
| PubChem CID | 174194136 |
| Molecular Formula | C11H16N+ |
| Molecular Weight | 162.26 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium |
| SMILES | C=C1C=C(C)C=C/C1=[N+](\C)CC |
| InChI | InChI=1S/C11H16N/c1-5-12(4)11-7-6-9(2)8-10(11)3/h6-8H,3,5H2,1-2,4H3/q+1/b12-11- |
| InChIKey | IAZBFSVNOPNCCM-QXMHVHEDSA-N |
| XLogP | 2.16 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium?
The IUPAC name of ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium (CID 174194136) is ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium.
What is the SMILES notation for ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium?
The canonical SMILES for ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium is C=C1C=C(C)C=C/C1=[N+](\C)CC.
What is the InChIKey of ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium?
The InChIKey is IAZBFSVNOPNCCM-QXMHVHEDSA-N. The full InChI is InChI=1S/C11H16N/c1-5-12(4)11-7-6-9(2)8-10(11)3/h6-8H,3,5H2,1-2,4H3/q+1/b12-11-.
What are the key properties of ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium?
ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium has a molecular weight of 162.26 g/mol, XLogP of 2.16, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-methyl-(4-methyl-6-methylidenecyclohexa-2,4-dien-1-ylidene)azanium is sourced from PubChem (CID 174194136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).