About 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine
1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine (PubChem CID 174194314) has the molecular formula C11H19FN2
and a molecular weight of 198.28 g/mol. Its IUPAC name is 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine |
| PubChem CID | 174194314 |
| Molecular Formula | C11H19FN2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine |
| SMILES | C/C=C(\C=C(/C)F)N1CCN(C)CC1 |
| InChI | InChI=1S/C11H19FN2/c1-4-11(9-10(2)12)14-7-5-13(3)6-8-14/h4,9H,5-8H2,1-3H3/b10-9+,11-4+ |
| InChIKey | DTYDZTNJKZPZRX-LFXAUOBFSA-N |
| XLogP | 2.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine?
The IUPAC name of 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine (CID 174194314) is 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine.
What is the SMILES notation for 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine?
The canonical SMILES for 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine is C/C=C(\C=C(/C)F)N1CCN(C)CC1.
What is the InChIKey of 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine?
The InChIKey is DTYDZTNJKZPZRX-LFXAUOBFSA-N. The full InChI is InChI=1S/C11H19FN2/c1-4-11(9-10(2)12)14-7-5-13(3)6-8-14/h4,9H,5-8H2,1-3H3/b10-9+,11-4+.
What are the key properties of 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine?
1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine has a molecular weight of 198.28 g/mol, XLogP of 2.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E,4E)-5-fluorohexa-2,4-dien-3-yl]-4-methylpiperazine is sourced from PubChem (CID 174194314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).