C26H28F6N2O2 — CID 174194335
(1S,3R)-1-[2,6-difluoro-4-[[3-(3-fluoropropyl)cyclobutyl]amino]phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinoline-6-carboxylic acid (PubChem CID 174194335) has the molecular formula C26H28F6N2O2 and a molecular weight of 514.51 g/mol. Its IUPAC name is (1S,3R)-1-[2,6-difluoro-4-[[3-(3-fluoropropyl)cyclobutyl]amino]phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinoline-6-carboxylic acid.
| Compound Name | (1S,3R)-1-[2,6-difluoro-4-[[3-(3-fluoropropyl)cyclobutyl]amino]phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 174194335 |
| Molecular Formula | C26H28F6N2O2 |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | (1S,3R)-1-[2,6-difluoro-4-[[3-(3-fluoropropyl)cyclobutyl]amino]phenyl]-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinoline-6-carboxylic acid |
| SMILES | C[C@@H]1Cc2cc(C(=O)O)ccc2[C@@H](c2c(F)cc(NC3CC(CCCF)C3)cc2F)N1CC(F)(F)F |
| InChI | InChI=1S/C26H28F6N2O2/c1-14-7-17-10-16(25(35)36)4-5-20(17)24(34(14)13-26(30,31)32)23-21(28)11-19(12-22(23)29)33-18-8-15(9-18)3-2-6-27/h4-5,10-12,14-15,18,24,33H,2-3,6-9,13H2,1H3,(H,35,36)/t14-,15?,18?,24+/m1/s1 |
| InChIKey | ASFZLOWKORDYSX-ZVPBZAOISA-N |
| XLogP | 6.50 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |